ChemNet > CAS > 21211-22-3 3-Chlorobenzo[b]-2-thiophenecarboxylic acid
21211-22-3 3-Chlorobenzo[b]-2-thiophenecarboxylic acid
Naam product |
3-Chlorobenzo[b]-2-thiophenecarboxylic acid |
Synoniemen |
3-Chlorobenzo[b]thiophene-2-carboxylic acid; 3-CHLORO-BENZO[B]THIOPHENE CARBOXYLIC ACID; 3-CHLORO-1-BENZOTHIOPHENE-2-CARBOXYLIC ACID; 3-CHLORO-2-BENZO[B]THIOPHENE CARBOXYLIC ACID; AKOS BBB/202; AKOS B000001; AKOS AU36-M200; BUTTPARK 30\06-07; 3-Chlorobenzothiophene-2-carboxylic acid |
MF |
C9H5ClO2S |
Molecuulgewicht |
212.6528 |
InChI |
InChI=1/C9H5ClO2S/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H,(H,11,12) |
CAS-nummer |
21211-22-3 |
Moleculaire Structuur |
|
Dichtheid |
1.546g/cm3 |
Kookpunt |
395.1°C at 760 mmHg |
Brekingsindex |
1.719 |
Vlampunt |
192.8°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|